C27H18N4O2 — CID 102423646
3-[4-(4-nitrophenyl)phenyl]-2,6-dipyridin-2-ylpyridine (PubChem CID 102423646) has the molecular formula C27H18N4O2 and a molecular weight of 430.47 g/mol. Its IUPAC name is 3-[4-(4-nitrophenyl)phenyl]-2,6-dipyridin-2-ylpyridine.
| Compound Name | 3-[4-(4-nitrophenyl)phenyl]-2,6-dipyridin-2-ylpyridine |
|---|---|
| PubChem CID | 102423646 |
| Molecular Formula | C27H18N4O2 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 3-[4-(4-nitrophenyl)phenyl]-2,6-dipyridin-2-ylpyridine |
| SMILES | O=[N+]([O-])c1ccc(-c2ccc(-c3ccc(-c4ccccn4)nc3-c3ccccn3)cc2)cc1 |
| InChI | InChI=1S/C27H18N4O2/c32-31(33)22-13-11-20(12-14-22)19-7-9-21(10-8-19)23-15-16-25(24-5-1-3-17-28-24)30-27(23)26-6-2-4-18-29-26/h1-18H |
| InChIKey | VFMUXLDUMUASPO-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 81.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|