About nickel(2+);2-pyridin-2-ylpyridine;nitrate
nickel(2+);2-pyridin-2-ylpyridine;nitrate (PubChem CID 22572268) has the molecular formula C10H8N3NiO3+
and a molecular weight of 276.88 g/mol. Its IUPAC name is nickel(2+);2-pyridin-2-ylpyridine;nitrate.
Molecular Properties
| Compound Name | nickel(2+);2-pyridin-2-ylpyridine;nitrate |
| PubChem CID | 22572268 |
| Molecular Formula | C10H8N3NiO3+ |
| Molecular Weight | 276.88 g/mol |
| Exact Mass | 275.99 |
| IUPAC Name | nickel(2+);2-pyridin-2-ylpyridine;nitrate |
| SMILES | O=[N+]([O-])[O-].[Ni+2].c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C10H8N2.NO3.Ni/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;2-1(3)4;/h1-8H;;/q;-1;+2 |
| InChIKey | DZRYCGNIVWAFGP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 91.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.88 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nickel(2+);2-pyridin-2-ylpyridine;nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nickel(2+);2-pyridin-2-ylpyridine;nitrate?
The IUPAC name of nickel(2+);2-pyridin-2-ylpyridine;nitrate (CID 22572268) is nickel(2+);2-pyridin-2-ylpyridine;nitrate.
What is the SMILES notation for nickel(2+);2-pyridin-2-ylpyridine;nitrate?
The canonical SMILES for nickel(2+);2-pyridin-2-ylpyridine;nitrate is O=[N+]([O-])[O-].[Ni+2].c1ccc(-c2ccccn2)nc1.
What is the InChIKey of nickel(2+);2-pyridin-2-ylpyridine;nitrate?
The InChIKey is DZRYCGNIVWAFGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2.NO3.Ni/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;2-1(3)4;/h1-8H;;/q;-1;+2.
What are the key properties of nickel(2+);2-pyridin-2-ylpyridine;nitrate?
nickel(2+);2-pyridin-2-ylpyridine;nitrate has a molecular weight of 276.88 g/mol, XLogP of 1.90, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for nickel(2+);2-pyridin-2-ylpyridine;nitrate is sourced from PubChem (CID 22572268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).