C21H14N4O2 — CID 12990785
4-(3-nitrophenyl)-2,6-dipyridin-2-ylpyridine (PubChem CID 12990785) has the molecular formula C21H14N4O2 and a molecular weight of 354.37 g/mol. Its IUPAC name is 4-(3-nitrophenyl)-2,6-dipyridin-2-ylpyridine.
| Compound Name | 4-(3-nitrophenyl)-2,6-dipyridin-2-ylpyridine |
|---|---|
| PubChem CID | 12990785 |
| Molecular Formula | C21H14N4O2 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 4-(3-nitrophenyl)-2,6-dipyridin-2-ylpyridine |
| SMILES | O=[N+]([O-])c1cccc(-c2cc(-c3ccccn3)nc(-c3ccccn3)c2)c1 |
| InChI | InChI=1S/C21H14N4O2/c26-25(27)17-7-5-6-15(12-17)16-13-20(18-8-1-3-10-22-18)24-21(14-16)19-9-2-4-11-23-19/h1-14H |
| InChIKey | GLNZHKNBOZBSPS-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 81.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|