C19H12N4O2S — CID 11417084
4-(5-nitrothiophen-2-yl)-2,6-dipyridin-2-ylpyridine (PubChem CID 11417084) has the molecular formula C19H12N4O2S and a molecular weight of 360.40 g/mol. Its IUPAC name is 4-(5-nitrothiophen-2-yl)-2,6-dipyridin-2-ylpyridine.
| Compound Name | 4-(5-nitrothiophen-2-yl)-2,6-dipyridin-2-ylpyridine |
|---|---|
| PubChem CID | 11417084 |
| Molecular Formula | C19H12N4O2S |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 4-(5-nitrothiophen-2-yl)-2,6-dipyridin-2-ylpyridine |
| SMILES | O=[N+]([O-])c1ccc(-c2cc(-c3ccccn3)nc(-c3ccccn3)c2)s1 |
| InChI | InChI=1S/C19H12N4O2S/c24-23(25)19-8-7-18(26-19)13-11-16(14-5-1-3-9-20-14)22-17(12-13)15-6-2-4-10-21-15/h1-12H |
| InChIKey | XVSDGAYIWMCCQH-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 81.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|