C18H12N2S2 — CID 10734487
2-pyridin-2-yl-4,6-dithiophen-2-ylpyridine (PubChem CID 10734487) has the molecular formula C18H12N2S2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 2-pyridin-2-yl-4,6-dithiophen-2-ylpyridine.
| Compound Name | 2-pyridin-2-yl-4,6-dithiophen-2-ylpyridine |
|---|---|
| PubChem CID | 10734487 |
| Molecular Formula | C18H12N2S2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 2-pyridin-2-yl-4,6-dithiophen-2-ylpyridine |
| SMILES | c1ccc(-c2cc(-c3cccs3)cc(-c3cccs3)n2)nc1 |
| InChI | InChI=1S/C18H12N2S2/c1-2-8-19-14(5-1)15-11-13(17-6-3-9-21-17)12-16(20-15)18-7-4-10-22-18/h1-12H |
| InChIKey | CJXCYURLNIWMMC-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |