C33H23NS — CID 140587162
2-[3-[3-(3-phenyl-5-thiophen-2-ylphenyl)phenyl]phenyl]pyridine (PubChem CID 140587162) has the molecular formula C33H23NS and a molecular weight of 465.62 g/mol. Its IUPAC name is 2-[3-[3-(3-phenyl-5-thiophen-2-ylphenyl)phenyl]phenyl]pyridine.
| Compound Name | 2-[3-[3-(3-phenyl-5-thiophen-2-ylphenyl)phenyl]phenyl]pyridine |
|---|---|
| PubChem CID | 140587162 |
| Molecular Formula | C33H23NS |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 2-[3-[3-(3-phenyl-5-thiophen-2-ylphenyl)phenyl]phenyl]pyridine |
| SMILES | c1ccc(-c2cc(-c3cccc(-c4cccc(-c5ccccn5)c4)c3)cc(-c3cccs3)c2)cc1 |
| InChI | InChI=1S/C33H23NS/c1-2-9-24(10-3-1)29-21-30(23-31(22-29)33-16-8-18-35-33)27-13-6-11-25(19-27)26-12-7-14-28(20-26)32-15-4-5-17-34-32/h1-23H |
| InChIKey | JGLNDYFYCGHFDO-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |