About platinum;bis(2-thiophen-2-ylpyridine)
platinum;bis(2-thiophen-2-ylpyridine) (PubChem CID 87764255) has the molecular formula C18H14N2PtS2
and a molecular weight of 517.54 g/mol. Its IUPAC name is platinum;bis(2-thiophen-2-ylpyridine).
Molecular Properties
| Compound Name | platinum;bis(2-thiophen-2-ylpyridine) |
| PubChem CID | 87764255 |
| Molecular Formula | C18H14N2PtS2 |
| Molecular Weight | 517.54 g/mol |
| Exact Mass | 517.02 |
| IUPAC Name | platinum;bis(2-thiophen-2-ylpyridine) |
| SMILES | [Pt].c1ccc(-c2cccs2)nc1.c1ccc(-c2cccs2)nc1 |
| InChI | InChI=1S/2C9H7NS.Pt/c2*1-2-6-10-8(4-1)9-5-3-7-11-9;/h2*1-7H; |
| InChIKey | YTYIWNMRWAVOAA-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 517.54 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze platinum;bis(2-thiophen-2-ylpyridine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of platinum;bis(2-thiophen-2-ylpyridine)?
The IUPAC name of platinum;bis(2-thiophen-2-ylpyridine) (CID 87764255) is platinum;bis(2-thiophen-2-ylpyridine).
What is the SMILES notation for platinum;bis(2-thiophen-2-ylpyridine)?
The canonical SMILES for platinum;bis(2-thiophen-2-ylpyridine) is [Pt].c1ccc(-c2cccs2)nc1.c1ccc(-c2cccs2)nc1.
What is the InChIKey of platinum;bis(2-thiophen-2-ylpyridine)?
The InChIKey is YTYIWNMRWAVOAA-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H7NS.Pt/c2*1-2-6-10-8(4-1)9-5-3-7-11-9;/h2*1-7H;.
What are the key properties of platinum;bis(2-thiophen-2-ylpyridine)?
platinum;bis(2-thiophen-2-ylpyridine) has a molecular weight of 517.54 g/mol, XLogP of 5.62, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for platinum;bis(2-thiophen-2-ylpyridine) is sourced from PubChem (CID 87764255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).