About dichloroiron;2-(5-pyridin-2-ylthiophen-2-yl)pyridine
dichloroiron;2-(5-pyridin-2-ylthiophen-2-yl)pyridine (PubChem CID 22968583) has the molecular formula C14H10Cl2FeN2S
and a molecular weight of 365.07 g/mol. Its IUPAC name is dichloroiron;2-(5-pyridin-2-ylthiophen-2-yl)pyridine.
Molecular Properties
| Compound Name | dichloroiron;2-(5-pyridin-2-ylthiophen-2-yl)pyridine |
| PubChem CID | 22968583 |
| Molecular Formula | C14H10Cl2FeN2S |
| Molecular Weight | 365.07 g/mol |
| Exact Mass | 363.93 |
| IUPAC Name | dichloroiron;2-(5-pyridin-2-ylthiophen-2-yl)pyridine |
| SMILES | Cl[Fe]Cl.c1ccc(-c2ccc(-c3ccccn3)s2)nc1 |
| InChI | InChI=1S/C14H10N2S.2ClH.Fe/c1-3-9-15-11(5-1)13-7-8-14(17-13)12-6-2-4-10-16-12;;;/h1-10H;2*1H;/q;;;+2/p-2 |
| InChIKey | JDEZLOPGYDIHGE-UHFFFAOYSA-L |
| XLogP | 5.25 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.07 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dichloroiron;2-(5-pyridin-2-ylthiophen-2-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloroiron;2-(5-pyridin-2-ylthiophen-2-yl)pyridine?
The IUPAC name of dichloroiron;2-(5-pyridin-2-ylthiophen-2-yl)pyridine (CID 22968583) is dichloroiron;2-(5-pyridin-2-ylthiophen-2-yl)pyridine.
What is the SMILES notation for dichloroiron;2-(5-pyridin-2-ylthiophen-2-yl)pyridine?
The canonical SMILES for dichloroiron;2-(5-pyridin-2-ylthiophen-2-yl)pyridine is Cl[Fe]Cl.c1ccc(-c2ccc(-c3ccccn3)s2)nc1.
What is the InChIKey of dichloroiron;2-(5-pyridin-2-ylthiophen-2-yl)pyridine?
The InChIKey is JDEZLOPGYDIHGE-UHFFFAOYSA-L. The full InChI is InChI=1S/C14H10N2S.2ClH.Fe/c1-3-9-15-11(5-1)13-7-8-14(17-13)12-6-2-4-10-16-12;;;/h1-10H;2*1H;/q;;;+2/p-2.
What are the key properties of dichloroiron;2-(5-pyridin-2-ylthiophen-2-yl)pyridine?
dichloroiron;2-(5-pyridin-2-ylthiophen-2-yl)pyridine has a molecular weight of 365.07 g/mol, XLogP of 5.25, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dichloroiron;2-(5-pyridin-2-ylthiophen-2-yl)pyridine is sourced from PubChem (CID 22968583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).