About iridium(3+);tris(3-oxobutanoate);2-thiophen-2-ylpyridine
iridium(3+);tris(3-oxobutanoate);2-thiophen-2-ylpyridine (PubChem CID 160918661) has the molecular formula C21H22IrNO9S
and a molecular weight of 656.69 g/mol. Its IUPAC name is iridium(3+);tris(3-oxobutanoate);2-thiophen-2-ylpyridine.
Molecular Properties
| Compound Name | iridium(3+);tris(3-oxobutanoate);2-thiophen-2-ylpyridine |
| PubChem CID | 160918661 |
| Molecular Formula | C21H22IrNO9S |
| Molecular Weight | 656.69 g/mol |
| Exact Mass | 657.06 |
| IUPAC Name | iridium(3+);tris(3-oxobutanoate);2-thiophen-2-ylpyridine |
| SMILES | CC(=O)CC(=O)[O-].CC(=O)CC(=O)[O-].CC(=O)CC(=O)[O-].[Ir+3].c1ccc(-c2cccs2)nc1 |
| InChI | InChI=1S/C9H7NS.3C4H6O3.Ir/c1-2-6-10-8(4-1)9-5-3-7-11-9;3*1-3(5)2-4(6)7;/h1-7H;3*2H2,1H3,(H,6,7);/q;;;;+3/p-3 |
| InChIKey | SRSWBUKVOPWIFP-UHFFFAOYSA-K |
| XLogP | -1.05 |
| TPSA | 184.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 656.69 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze iridium(3+);tris(3-oxobutanoate);2-thiophen-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium(3+);tris(3-oxobutanoate);2-thiophen-2-ylpyridine?
The IUPAC name of iridium(3+);tris(3-oxobutanoate);2-thiophen-2-ylpyridine (CID 160918661) is iridium(3+);tris(3-oxobutanoate);2-thiophen-2-ylpyridine.
What is the SMILES notation for iridium(3+);tris(3-oxobutanoate);2-thiophen-2-ylpyridine?
The canonical SMILES for iridium(3+);tris(3-oxobutanoate);2-thiophen-2-ylpyridine is CC(=O)CC(=O)[O-].CC(=O)CC(=O)[O-].CC(=O)CC(=O)[O-].[Ir+3].c1ccc(-c2cccs2)nc1.
What is the InChIKey of iridium(3+);tris(3-oxobutanoate);2-thiophen-2-ylpyridine?
The InChIKey is SRSWBUKVOPWIFP-UHFFFAOYSA-K. The full InChI is InChI=1S/C9H7NS.3C4H6O3.Ir/c1-2-6-10-8(4-1)9-5-3-7-11-9;3*1-3(5)2-4(6)7;/h1-7H;3*2H2,1H3,(H,6,7);/q;;;;+3/p-3.
What are the key properties of iridium(3+);tris(3-oxobutanoate);2-thiophen-2-ylpyridine?
iridium(3+);tris(3-oxobutanoate);2-thiophen-2-ylpyridine has a molecular weight of 656.69 g/mol, XLogP of -1.05, 7 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for iridium(3+);tris(3-oxobutanoate);2-thiophen-2-ylpyridine is sourced from PubChem (CID 160918661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).