About 2-[3-(3,5-dithiophen-2-ylphenyl)-5-thiophen-2-ylphenyl]thiophene
2-[3-(3,5-dithiophen-2-ylphenyl)-5-thiophen-2-ylphenyl]thiophene (PubChem CID 25194793) has the molecular formula C28H18S4
and a molecular weight of 482.72 g/mol. Its IUPAC name is 2-[3-(3,5-dithiophen-2-ylphenyl)-5-thiophen-2-ylphenyl]thiophene.
Molecular Properties
| Compound Name | 2-[3-(3,5-dithiophen-2-ylphenyl)-5-thiophen-2-ylphenyl]thiophene |
| PubChem CID | 25194793 |
| Molecular Formula | C28H18S4 |
| Molecular Weight | 482.72 g/mol |
| Exact Mass | 482.03 |
| IUPAC Name | 2-[3-(3,5-dithiophen-2-ylphenyl)-5-thiophen-2-ylphenyl]thiophene |
| SMILES | c1csc(-c2cc(-c3cc(-c4cccs4)cc(-c4cccs4)c3)cc(-c3cccs3)c2)c1 |
| InChI | InChI=1S/C28H18S4/c1-5-25(29-9-1)21-13-19(14-22(17-21)26-6-2-10-30-26)20-15-23(27-7-3-11-31-27)18-24(16-20)28-8-4-12-32-28/h1-18H |
| InChIKey | JFSZQYWDGQIARV-UHFFFAOYSA-N |
| XLogP | 10.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 482.72 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3-(3,5-dithiophen-2-ylphenyl)-5-thiophen-2-ylphenyl]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(3,5-dithiophen-2-ylphenyl)-5-thiophen-2-ylphenyl]thiophene?
The IUPAC name of 2-[3-(3,5-dithiophen-2-ylphenyl)-5-thiophen-2-ylphenyl]thiophene (CID 25194793) is 2-[3-(3,5-dithiophen-2-ylphenyl)-5-thiophen-2-ylphenyl]thiophene.
What is the SMILES notation for 2-[3-(3,5-dithiophen-2-ylphenyl)-5-thiophen-2-ylphenyl]thiophene?
The canonical SMILES for 2-[3-(3,5-dithiophen-2-ylphenyl)-5-thiophen-2-ylphenyl]thiophene is c1csc(-c2cc(-c3cc(-c4cccs4)cc(-c4cccs4)c3)cc(-c3cccs3)c2)c1.
What is the InChIKey of 2-[3-(3,5-dithiophen-2-ylphenyl)-5-thiophen-2-ylphenyl]thiophene?
The InChIKey is JFSZQYWDGQIARV-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H18S4/c1-5-25(29-9-1)21-13-19(14-22(17-21)26-6-2-10-30-26)20-15-23(27-7-3-11-31-27)18-24(16-20)28-8-4-12-32-28/h1-18H.
What are the key properties of 2-[3-(3,5-dithiophen-2-ylphenyl)-5-thiophen-2-ylphenyl]thiophene?
2-[3-(3,5-dithiophen-2-ylphenyl)-5-thiophen-2-ylphenyl]thiophene has a molecular weight of 482.72 g/mol, XLogP of 10.27, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(3,5-dithiophen-2-ylphenyl)-5-thiophen-2-ylphenyl]thiophene is sourced from PubChem (CID 25194793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).