C12H12OS — CID 173292102
2,3-dimethyl-5-thiophen-2-ylphenol (PubChem CID 173292102) has the molecular formula C12H12OS and a molecular weight of 204.29 g/mol. Its IUPAC name is 2,3-dimethyl-5-thiophen-2-ylphenol.
| Compound Name | 2,3-dimethyl-5-thiophen-2-ylphenol |
|---|---|
| PubChem CID | 173292102 |
| Molecular Formula | C12H12OS |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 2,3-dimethyl-5-thiophen-2-ylphenol |
| SMILES | Cc1cc(-c2cccs2)cc(O)c1C |
| InChI | InChI=1S/C12H12OS/c1-8-6-10(7-11(13)9(8)2)12-4-3-5-14-12/h3-7,13H,1-2H3 |
| InChIKey | JJYLAHZKBMMZIV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |