C19H17NOS — CID 68907909
N-(2,6-dimethyl-4-thiophen-2-ylphenyl)benzamide (PubChem CID 68907909) has the molecular formula C19H17NOS and a molecular weight of 307.42 g/mol. Its IUPAC name is N-(2,6-dimethyl-4-thiophen-2-ylphenyl)benzamide.
| Compound Name | N-(2,6-dimethyl-4-thiophen-2-ylphenyl)benzamide |
|---|---|
| PubChem CID | 68907909 |
| Molecular Formula | C19H17NOS |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | N-(2,6-dimethyl-4-thiophen-2-ylphenyl)benzamide |
| SMILES | Cc1cc(-c2cccs2)cc(C)c1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H17NOS/c1-13-11-16(17-9-6-10-22-17)12-14(2)18(13)20-19(21)15-7-4-3-5-8-15/h3-12H,1-2H3,(H,20,21) |
| InChIKey | JEMSSNWAFQNYPN-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |