C11H11NS3 — CID 14202028
2,6-bis(methylsulfanyl)-4-thiophen-2-ylpyridine (PubChem CID 14202028) has the molecular formula C11H11NS3 and a molecular weight of 253.42 g/mol. Its IUPAC name is 2,6-bis(methylsulfanyl)-4-thiophen-2-ylpyridine.
| Compound Name | 2,6-bis(methylsulfanyl)-4-thiophen-2-ylpyridine |
|---|---|
| PubChem CID | 14202028 |
| Molecular Formula | C11H11NS3 |
| Molecular Weight | 253.42 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | 2,6-bis(methylsulfanyl)-4-thiophen-2-ylpyridine |
| SMILES | CSc1cc(-c2cccs2)cc(SC)n1 |
| InChI | InChI=1S/C11H11NS3/c1-13-10-6-8(7-11(12-10)14-2)9-4-3-5-15-9/h3-7H,1-2H3 |
| InChIKey | XHPVGKADPRDTRG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |