C13H10S4 — CID 15273180
3-methylsulfanyl-2,5-dithiophen-2-ylthiophene (PubChem CID 15273180) has the molecular formula C13H10S4 and a molecular weight of 294.49 g/mol. Its IUPAC name is 3-methylsulfanyl-2,5-dithiophen-2-ylthiophene.
| Compound Name | 3-methylsulfanyl-2,5-dithiophen-2-ylthiophene |
|---|---|
| PubChem CID | 15273180 |
| Molecular Formula | C13H10S4 |
| Molecular Weight | 294.49 g/mol |
| Exact Mass | 293.97 |
| IUPAC Name | 3-methylsulfanyl-2,5-dithiophen-2-ylthiophene |
| SMILES | CSc1cc(-c2cccs2)sc1-c1cccs1 |
| InChI | InChI=1S/C13H10S4/c1-14-12-8-11(9-4-2-6-15-9)17-13(12)10-5-3-7-16-10/h2-8H,1H3 |
| InChIKey | KTPBFSXTCTVACE-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.49 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |