About 3-methylsulfanyl-2,5-dithiophen-2-ylthiophene
3-methylsulfanyl-2,5-dithiophen-2-ylthiophene (PubChem CID 15273180) has the molecular formula C13H10S4
and a molecular weight of 294.49 g/mol. Its IUPAC name is 3-methylsulfanyl-2,5-dithiophen-2-ylthiophene.
Molecular Properties
| Compound Name | 3-methylsulfanyl-2,5-dithiophen-2-ylthiophene |
| PubChem CID | 15273180 |
| Molecular Formula | C13H10S4 |
| Molecular Weight | 294.49 g/mol |
| Exact Mass | 293.97 |
| IUPAC Name | 3-methylsulfanyl-2,5-dithiophen-2-ylthiophene |
| SMILES | CSc1cc(-c2cccs2)sc1-c1cccs1 |
| InChI | InChI=1S/C13H10S4/c1-14-12-8-11(9-4-2-6-15-9)17-13(12)10-5-3-7-16-10/h2-8H,1H3 |
| InChIKey | KTPBFSXTCTVACE-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.49 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methylsulfanyl-2,5-dithiophen-2-ylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylsulfanyl-2,5-dithiophen-2-ylthiophene?
The IUPAC name of 3-methylsulfanyl-2,5-dithiophen-2-ylthiophene (CID 15273180) is 3-methylsulfanyl-2,5-dithiophen-2-ylthiophene.
What is the SMILES notation for 3-methylsulfanyl-2,5-dithiophen-2-ylthiophene?
The canonical SMILES for 3-methylsulfanyl-2,5-dithiophen-2-ylthiophene is CSc1cc(-c2cccs2)sc1-c1cccs1.
What is the InChIKey of 3-methylsulfanyl-2,5-dithiophen-2-ylthiophene?
The InChIKey is KTPBFSXTCTVACE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10S4/c1-14-12-8-11(9-4-2-6-15-9)17-13(12)10-5-3-7-16-10/h2-8H,1H3.
What are the key properties of 3-methylsulfanyl-2,5-dithiophen-2-ylthiophene?
3-methylsulfanyl-2,5-dithiophen-2-ylthiophene has a molecular weight of 294.49 g/mol, XLogP of 5.93, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylsulfanyl-2,5-dithiophen-2-ylthiophene is sourced from PubChem (CID 15273180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).