C22H16O4S4 — CID 90324246
4,9-dithiophen-2-yl-13,16,17,20-tetraoxa-5,8-dithiapentacyclo[10.4.4.01,12.02,6.07,11]icosa-2(6),3,7(11),9-tetraene (PubChem CID 90324246) has the molecular formula C22H16O4S4 and a molecular weight of 472.63 g/mol. Its IUPAC name is 4,9-dithiophen-2-yl-13,16,17,20-tetraoxa-5,8-dithiapentacyclo[10.4.4.01,12.02,6.07,11]icosa-2(6),3,7(11),9-tetraene.
| Compound Name | 4,9-dithiophen-2-yl-13,16,17,20-tetraoxa-5,8-dithiapentacyclo[10.4.4.01,12.02,6.07,11]icosa-2(6),3,7(11),9-tetraene |
|---|---|
| PubChem CID | 90324246 |
| Molecular Formula | C22H16O4S4 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 471.99 |
| IUPAC Name | 4,9-dithiophen-2-yl-13,16,17,20-tetraoxa-5,8-dithiapentacyclo[10.4.4.01,12.02,6.07,11]icosa-2(6),3,7(11),9-tetraene |
| SMILES | c1csc(-c2cc3c(s2)-c2sc(-c4cccs4)cc2C24OCCOC32OCCO4)c1 |
| InChI | InChI=1S/C22H16O4S4/c1-3-15(27-9-1)17-11-13-19(29-17)20-14(12-18(30-20)16-4-2-10-28-16)22-21(13,23-5-7-25-22)24-6-8-26-22/h1-4,9-12H,5-8H2 |
| InChIKey | BSDBAORJVDSLFK-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |