C17H12OS3 — CID 14921930
2-[5-thiophen-2-yl-3-(thiophen-2-ylmethyl)thiophen-2-yl]furan (PubChem CID 14921930) has the molecular formula C17H12OS3 and a molecular weight of 328.48 g/mol. Its IUPAC name is 2-[5-thiophen-2-yl-3-(thiophen-2-ylmethyl)thiophen-2-yl]furan.
| Compound Name | 2-[5-thiophen-2-yl-3-(thiophen-2-ylmethyl)thiophen-2-yl]furan |
|---|---|
| PubChem CID | 14921930 |
| Molecular Formula | C17H12OS3 |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 2-[5-thiophen-2-yl-3-(thiophen-2-ylmethyl)thiophen-2-yl]furan |
| SMILES | c1coc(-c2sc(-c3cccs3)cc2Cc2cccs2)c1 |
| InChI | InChI=1S/C17H12OS3/c1-5-14(18-7-1)17-12(10-13-4-2-8-19-13)11-16(21-17)15-6-3-9-20-15/h1-9,11H,10H2 |
| InChIKey | CVDGKSZMVHLNEP-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |