C12H10N2S2 — CID 141117900
5-thiophen-2-yl-4-(thiophen-2-ylmethyl)-1H-pyrazole (PubChem CID 141117900) has the molecular formula C12H10N2S2 and a molecular weight of 246.36 g/mol. Its IUPAC name is 5-thiophen-2-yl-4-(thiophen-2-ylmethyl)-1H-pyrazole.
| Compound Name | 5-thiophen-2-yl-4-(thiophen-2-ylmethyl)-1H-pyrazole |
|---|---|
| PubChem CID | 141117900 |
| Molecular Formula | C12H10N2S2 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | 5-thiophen-2-yl-4-(thiophen-2-ylmethyl)-1H-pyrazole |
| SMILES | c1csc(Cc2cn[nH]c2-c2cccs2)c1 |
| InChI | InChI=1S/C12H10N2S2/c1-3-10(15-5-1)7-9-8-13-14-12(9)11-4-2-6-16-11/h1-6,8H,7H2,(H,13,14) |
| InChIKey | YBISLYYMPJIMQC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |