C14H21N3S — CID 47185945
3,3-dimethyl-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]butan-1-amine (PubChem CID 47185945) has the molecular formula C14H21N3S and a molecular weight of 263.41 g/mol. Its IUPAC name is 3,3-dimethyl-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]butan-1-amine.
| Compound Name | 3,3-dimethyl-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 47185945 |
| Molecular Formula | C14H21N3S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 3,3-dimethyl-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]butan-1-amine |
| SMILES | CC(C)(C)CCNCc1cn[nH]c1-c1cccs1 |
| InChI | InChI=1S/C14H21N3S/c1-14(2,3)6-7-15-9-11-10-16-17-13(11)12-5-4-8-18-12/h4-5,8,10,15H,6-7,9H2,1-3H3,(H,16,17) |
| InChIKey | HGMRQZWCGWEJFA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|