C17H18FN3OS — CID 154834574
2-(4-fluorophenyl)-1-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methylamino]propan-2-ol (PubChem CID 154834574) has the molecular formula C17H18FN3OS and a molecular weight of 331.42 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-1-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methylamino]propan-2-ol.
| Compound Name | 2-(4-fluorophenyl)-1-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methylamino]propan-2-ol |
|---|---|
| PubChem CID | 154834574 |
| Molecular Formula | C17H18FN3OS |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 2-(4-fluorophenyl)-1-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methylamino]propan-2-ol |
| SMILES | CC(O)(CNCc1cn[nH]c1-c1cccs1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H18FN3OS/c1-17(22,13-4-6-14(18)7-5-13)11-19-9-12-10-20-21-16(12)15-3-2-8-23-15/h2-8,10,19,22H,9,11H2,1H3,(H,20,21) |
| InChIKey | DHINGSFIPUTILM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |