C15H14FN3S — CID 43233210
1-(2-fluorophenyl)-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]methanamine (PubChem CID 43233210) has the molecular formula C15H14FN3S and a molecular weight of 287.36 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]methanamine.
| Compound Name | 1-(2-fluorophenyl)-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]methanamine |
|---|---|
| PubChem CID | 43233210 |
| Molecular Formula | C15H14FN3S |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 1-(2-fluorophenyl)-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]methanamine |
| SMILES | Fc1ccccc1CNCc1cn[nH]c1-c1cccs1 |
| InChI | InChI=1S/C15H14FN3S/c16-13-5-2-1-4-11(13)8-17-9-12-10-18-19-15(12)14-6-3-7-20-14/h1-7,10,17H,8-9H2,(H,18,19) |
| InChIKey | SEXLNNXZEMMZDX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |