C24H21N3OS — CID 19973545
(E)-N-(1,2-diphenylethyl)-3-(5-thiophen-2-yl-1H-pyrazol-4-yl)prop-2-enamide (PubChem CID 19973545) has the molecular formula C24H21N3OS and a molecular weight of 399.52 g/mol. Its IUPAC name is (E)-N-(1,2-diphenylethyl)-3-(5-thiophen-2-yl-1H-pyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-(1,2-diphenylethyl)-3-(5-thiophen-2-yl-1H-pyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 19973545 |
| Molecular Formula | C24H21N3OS |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | (E)-N-(1,2-diphenylethyl)-3-(5-thiophen-2-yl-1H-pyrazol-4-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cn[nH]c1-c1cccs1)NC(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H21N3OS/c28-23(14-13-20-17-25-27-24(20)22-12-7-15-29-22)26-21(19-10-5-2-6-11-19)16-18-8-3-1-4-9-18/h1-15,17,21H,16H2,(H,25,27)(H,26,28)/b14-13+ |
| InChIKey | PCAUEVGCSUDMQT-BUHFOSPRSA-N |
| XLogP | 5.25 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|