C19H26N4OS — CID 110201595
(8aR,11aS)-1-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]-3,4,5,6,7,8a,9,10,11,11a-decahydro-2H-cyclopenta[b][1,5]diazecin-8-one (PubChem CID 110201595) has the molecular formula C19H26N4OS and a molecular weight of 358.51 g/mol. Its IUPAC name is (8aR,11aS)-1-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]-3,4,5,6,7,8a,9,10,11,11a-decahydro-2H-cyclopenta[b][1,5]diazecin-8-one.
| Compound Name | (8aR,11aS)-1-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]-3,4,5,6,7,8a,9,10,11,11a-decahydro-2H-cyclopenta[b][1,5]diazecin-8-one |
|---|---|
| PubChem CID | 110201595 |
| Molecular Formula | C19H26N4OS |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | (8aR,11aS)-1-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]-3,4,5,6,7,8a,9,10,11,11a-decahydro-2H-cyclopenta[b][1,5]diazecin-8-one |
| SMILES | O=C1NCCCCCN(Cc2cn[nH]c2-c2cccs2)[C@H]2CCC[C@@H]12 |
| InChI | InChI=1S/C19H26N4OS/c24-19-15-6-4-7-16(15)23(10-3-1-2-9-20-19)13-14-12-21-22-18(14)17-8-5-11-25-17/h5,8,11-12,15-16H,1-4,6-7,9-10,13H2,(H,20,24)(H,21,22)/t15-,16+/m1/s1 |
| InChIKey | BWGPOGOFHMWTDM-CVEARBPZSA-N |
| XLogP | 3.41 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |