C17H26N4OS — CID 38066242
(2S)-2-methyl-2-morpholin-4-yl-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]butan-1-amine (PubChem CID 38066242) has the molecular formula C17H26N4OS and a molecular weight of 334.49 g/mol. Its IUPAC name is (2S)-2-methyl-2-morpholin-4-yl-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]butan-1-amine.
| Compound Name | (2S)-2-methyl-2-morpholin-4-yl-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 38066242 |
| Molecular Formula | C17H26N4OS |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | (2S)-2-methyl-2-morpholin-4-yl-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]butan-1-amine |
| SMILES | CC[C@@](C)(CNCc1cn[nH]c1-c1cccs1)N1CCOCC1 |
| InChI | InChI=1S/C17H26N4OS/c1-3-17(2,21-6-8-22-9-7-21)13-18-11-14-12-19-20-16(14)15-5-4-10-23-15/h4-5,10,12,18H,3,6-9,11,13H2,1-2H3,(H,19,20)/t17-/m0/s1 |
| InChIKey | LQIDUHCFSIWRRA-KRWDZBQOSA-N |
| XLogP | 2.73 |
| TPSA | 53.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |