C14H10F3N3S — CID 62809140
3,4,5-trifluoro-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]aniline (PubChem CID 62809140) has the molecular formula C14H10F3N3S and a molecular weight of 309.32 g/mol. Its IUPAC name is 3,4,5-trifluoro-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]aniline.
| Compound Name | 3,4,5-trifluoro-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 62809140 |
| Molecular Formula | C14H10F3N3S |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 3,4,5-trifluoro-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]aniline |
| SMILES | Fc1cc(NCc2cn[nH]c2-c2cccs2)cc(F)c1F |
| InChI | InChI=1S/C14H10F3N3S/c15-10-4-9(5-11(16)13(10)17)18-6-8-7-19-20-14(8)12-2-1-3-21-12/h1-5,7,18H,6H2,(H,19,20) |
| InChIKey | OHBUCCLLWQMFGF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|