C14H10BrClFN3S — CID 107610739
2-bromo-6-chloro-4-fluoro-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]aniline (PubChem CID 107610739) has the molecular formula C14H10BrClFN3S and a molecular weight of 386.68 g/mol. Its IUPAC name is 2-bromo-6-chloro-4-fluoro-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]aniline.
| Compound Name | 2-bromo-6-chloro-4-fluoro-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 107610739 |
| Molecular Formula | C14H10BrClFN3S |
| Molecular Weight | 386.68 g/mol |
| Exact Mass | 384.95 |
| IUPAC Name | 2-bromo-6-chloro-4-fluoro-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]aniline |
| SMILES | Fc1cc(Cl)c(NCc2cn[nH]c2-c2cccs2)c(Br)c1 |
| InChI | InChI=1S/C14H10BrClFN3S/c15-10-4-9(17)5-11(16)14(10)18-6-8-7-19-20-13(8)12-2-1-3-21-12/h1-5,7,18H,6H2,(H,19,20) |
| InChIKey | BKDSFBGIUSIDOL-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.68 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |