C13H10BrClN4S — CID 103930517
5-bromo-6-chloro-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]pyridin-3-amine (PubChem CID 103930517) has the molecular formula C13H10BrClN4S and a molecular weight of 369.68 g/mol. Its IUPAC name is 5-bromo-6-chloro-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]pyridin-3-amine.
| Compound Name | 5-bromo-6-chloro-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]pyridin-3-amine |
|---|---|
| PubChem CID | 103930517 |
| Molecular Formula | C13H10BrClN4S |
| Molecular Weight | 369.68 g/mol |
| Exact Mass | 367.95 |
| IUPAC Name | 5-bromo-6-chloro-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]pyridin-3-amine |
| SMILES | Clc1ncc(NCc2cn[nH]c2-c2cccs2)cc1Br |
| InChI | InChI=1S/C13H10BrClN4S/c14-10-4-9(7-17-13(10)15)16-5-8-6-18-19-12(8)11-2-1-3-20-11/h1-4,6-7,16H,5H2,(H,18,19) |
| InChIKey | FKBAHSWFCUATRV-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.68 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|