C14H14N4S — CID 79041980
2-methyl-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]pyridin-3-amine (PubChem CID 79041980) has the molecular formula C14H14N4S and a molecular weight of 270.36 g/mol. Its IUPAC name is 2-methyl-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]pyridin-3-amine.
| Compound Name | 2-methyl-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]pyridin-3-amine |
|---|---|
| PubChem CID | 79041980 |
| Molecular Formula | C14H14N4S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 2-methyl-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]pyridin-3-amine |
| SMILES | Cc1ncccc1NCc1cn[nH]c1-c1cccs1 |
| InChI | InChI=1S/C14H14N4S/c1-10-12(4-2-6-15-10)16-8-11-9-17-18-14(11)13-5-3-7-19-13/h2-7,9,16H,8H2,1H3,(H,17,18) |
| InChIKey | VBAGKVGPHOAPND-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |