C13H11ClN4S — CID 83166919
4-chloro-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]pyridin-3-amine (PubChem CID 83166919) has the molecular formula C13H11ClN4S and a molecular weight of 290.78 g/mol. Its IUPAC name is 4-chloro-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]pyridin-3-amine.
| Compound Name | 4-chloro-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]pyridin-3-amine |
|---|---|
| PubChem CID | 83166919 |
| Molecular Formula | C13H11ClN4S |
| Molecular Weight | 290.78 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 4-chloro-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]pyridin-3-amine |
| SMILES | Clc1ccncc1NCc1cn[nH]c1-c1cccs1 |
| InChI | InChI=1S/C13H11ClN4S/c14-10-3-4-15-8-11(10)16-6-9-7-17-18-13(9)12-2-1-5-19-12/h1-5,7-8,16H,6H2,(H,17,18) |
| InChIKey | MIRIRVNUODGFEX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.78 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |