C14H15N3S2 — CID 43233218
1-thiophen-2-yl-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]ethanamine (PubChem CID 43233218) has the molecular formula C14H15N3S2 and a molecular weight of 289.43 g/mol. Its IUPAC name is 1-thiophen-2-yl-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]ethanamine.
| Compound Name | 1-thiophen-2-yl-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 43233218 |
| Molecular Formula | C14H15N3S2 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 1-thiophen-2-yl-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]ethanamine |
| SMILES | CC(NCc1cn[nH]c1-c1cccs1)c1cccs1 |
| InChI | InChI=1S/C14H15N3S2/c1-10(12-4-2-6-18-12)15-8-11-9-16-17-14(11)13-5-3-7-19-13/h2-7,9-10,15H,8H2,1H3,(H,16,17) |
| InChIKey | LDSCFOKNIHEUTE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |