C16H24N4S — CID 43791776
1-piperidin-1-yl-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]propan-2-amine (PubChem CID 43791776) has the molecular formula C16H24N4S and a molecular weight of 304.46 g/mol. Its IUPAC name is 1-piperidin-1-yl-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]propan-2-amine.
| Compound Name | 1-piperidin-1-yl-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 43791776 |
| Molecular Formula | C16H24N4S |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 1-piperidin-1-yl-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]propan-2-amine |
| SMILES | CC(CN1CCCCC1)NCc1cn[nH]c1-c1cccs1 |
| InChI | InChI=1S/C16H24N4S/c1-13(12-20-7-3-2-4-8-20)17-10-14-11-18-19-16(14)15-6-5-9-21-15/h5-6,9,11,13,17H,2-4,7-8,10,12H2,1H3,(H,18,19) |
| InChIKey | VPGCLNVKMCGTDD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |