C13H11N3OS2 — CID 71824121
5-thiophen-2-yl-N-(thiophen-2-ylmethyl)-1H-pyrazole-4-carboxamide (PubChem CID 71824121) has the molecular formula C13H11N3OS2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 5-thiophen-2-yl-N-(thiophen-2-ylmethyl)-1H-pyrazole-4-carboxamide.
| Compound Name | 5-thiophen-2-yl-N-(thiophen-2-ylmethyl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 71824121 |
| Molecular Formula | C13H11N3OS2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 5-thiophen-2-yl-N-(thiophen-2-ylmethyl)-1H-pyrazole-4-carboxamide |
| SMILES | O=C(NCc1cccs1)c1cn[nH]c1-c1cccs1 |
| InChI | InChI=1S/C13H11N3OS2/c17-13(14-7-9-3-1-5-18-9)10-8-15-16-12(10)11-4-2-6-19-11/h1-6,8H,7H2,(H,14,17)(H,15,16) |
| InChIKey | ZNDTVEQIXKXRMD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |