C13H15N3OS — CID 71824156
N-cyclopentyl-5-thiophen-2-yl-1H-pyrazole-4-carboxamide (PubChem CID 71824156) has the molecular formula C13H15N3OS and a molecular weight of 261.35 g/mol. Its IUPAC name is N-cyclopentyl-5-thiophen-2-yl-1H-pyrazole-4-carboxamide.
| Compound Name | N-cyclopentyl-5-thiophen-2-yl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 71824156 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | N-cyclopentyl-5-thiophen-2-yl-1H-pyrazole-4-carboxamide |
| SMILES | O=C(NC1CCCC1)c1cn[nH]c1-c1cccs1 |
| InChI | InChI=1S/C13H15N3OS/c17-13(15-9-4-1-2-5-9)10-8-14-16-12(10)11-6-3-7-18-11/h3,6-9H,1-2,4-5H2,(H,14,16)(H,15,17) |
| InChIKey | LZRJVXXQYQEEKG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |