C15H11N3O3S — CID 142738671
3-[(5-thiophen-2-yl-1H-pyrazole-4-carbonyl)amino]benzoic acid (PubChem CID 142738671) has the molecular formula C15H11N3O3S and a molecular weight of 313.34 g/mol. Its IUPAC name is 3-[(5-thiophen-2-yl-1H-pyrazole-4-carbonyl)amino]benzoic acid.
| Compound Name | 3-[(5-thiophen-2-yl-1H-pyrazole-4-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 142738671 |
| Molecular Formula | C15H11N3O3S |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 3-[(5-thiophen-2-yl-1H-pyrazole-4-carbonyl)amino]benzoic acid |
| SMILES | O=C(O)c1cccc(NC(=O)c2cn[nH]c2-c2cccs2)c1 |
| InChI | InChI=1S/C15H11N3O3S/c19-14(17-10-4-1-3-9(7-10)15(20)21)11-8-16-18-13(11)12-5-2-6-22-12/h1-8H,(H,16,18)(H,17,19)(H,20,21) |
| InChIKey | GSSVEGJLIAEAJC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |