C20H17ClN4O4 — CID 56548711
methyl 2-[[3-[[5-(4-chlorophenyl)-1H-pyrazole-4-carbonyl]amino]benzoyl]amino]acetate (PubChem CID 56548711) has the molecular formula C20H17ClN4O4 and a molecular weight of 412.83 g/mol. Its IUPAC name is methyl 2-[[3-[[5-(4-chlorophenyl)-1H-pyrazole-4-carbonyl]amino]benzoyl]amino]acetate.
| Compound Name | methyl 2-[[3-[[5-(4-chlorophenyl)-1H-pyrazole-4-carbonyl]amino]benzoyl]amino]acetate |
|---|---|
| PubChem CID | 56548711 |
| Molecular Formula | C20H17ClN4O4 |
| Molecular Weight | 412.83 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | methyl 2-[[3-[[5-(4-chlorophenyl)-1H-pyrazole-4-carbonyl]amino]benzoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1cccc(NC(=O)c2cn[nH]c2-c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C20H17ClN4O4/c1-29-17(26)11-22-19(27)13-3-2-4-15(9-13)24-20(28)16-10-23-25-18(16)12-5-7-14(21)8-6-12/h2-10H,11H2,1H3,(H,22,27)(H,23,25)(H,24,28) |
| InChIKey | LUWWMOIYHYCWQG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.83 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |