C19H18ClN3O4 — CID 17433645
5-(4-chlorophenyl)-N-(3,4,5-trimethoxyphenyl)-1H-pyrazole-4-carboxamide (PubChem CID 17433645) has the molecular formula C19H18ClN3O4 and a molecular weight of 387.82 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-(3,4,5-trimethoxyphenyl)-1H-pyrazole-4-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-N-(3,4,5-trimethoxyphenyl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 17433645 |
| Molecular Formula | C19H18ClN3O4 |
| Molecular Weight | 387.82 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 5-(4-chlorophenyl)-N-(3,4,5-trimethoxyphenyl)-1H-pyrazole-4-carboxamide |
| SMILES | COc1cc(NC(=O)c2cn[nH]c2-c2ccc(Cl)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C19H18ClN3O4/c1-25-15-8-13(9-16(26-2)18(15)27-3)22-19(24)14-10-21-23-17(14)11-4-6-12(20)7-5-11/h4-10H,1-3H3,(H,21,23)(H,22,24) |
| InChIKey | HFEPAZRRSOKROC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.82 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |