C11H9FN2OS — CID 115645421
3-fluoro-N-(thiophen-2-ylmethyl)pyridine-4-carboxamide (PubChem CID 115645421) has the molecular formula C11H9FN2OS and a molecular weight of 236.27 g/mol. Its IUPAC name is 3-fluoro-N-(thiophen-2-ylmethyl)pyridine-4-carboxamide.
| Compound Name | 3-fluoro-N-(thiophen-2-ylmethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 115645421 |
| Molecular Formula | C11H9FN2OS |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 3-fluoro-N-(thiophen-2-ylmethyl)pyridine-4-carboxamide |
| SMILES | O=C(NCc1cccs1)c1ccncc1F |
| InChI | InChI=1S/C11H9FN2OS/c12-10-7-13-4-3-9(10)11(15)14-6-8-2-1-5-16-8/h1-5,7H,6H2,(H,14,15) |
| InChIKey | ZCPGAWSIDVGRMX-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |