C14H13FN2OS — CID 115645728
N-cyclopropyl-3-fluoro-N-(thiophen-2-ylmethyl)pyridine-4-carboxamide (PubChem CID 115645728) has the molecular formula C14H13FN2OS and a molecular weight of 276.34 g/mol. Its IUPAC name is N-cyclopropyl-3-fluoro-N-(thiophen-2-ylmethyl)pyridine-4-carboxamide.
| Compound Name | N-cyclopropyl-3-fluoro-N-(thiophen-2-ylmethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 115645728 |
| Molecular Formula | C14H13FN2OS |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | N-cyclopropyl-3-fluoro-N-(thiophen-2-ylmethyl)pyridine-4-carboxamide |
| SMILES | O=C(c1ccncc1F)N(Cc1cccs1)C1CC1 |
| InChI | InChI=1S/C14H13FN2OS/c15-13-8-16-6-5-12(13)14(18)17(10-3-4-10)9-11-2-1-7-19-11/h1-2,5-8,10H,3-4,9H2 |
| InChIKey | ATVOYESQUOUSRH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |