C13H16FN3O2 — CID 115645919
N-(2-amino-2-oxoethyl)-N-cyclopentyl-3-fluoropyridine-4-carboxamide (PubChem CID 115645919) has the molecular formula C13H16FN3O2 and a molecular weight of 265.29 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-N-cyclopentyl-3-fluoropyridine-4-carboxamide.
| Compound Name | N-(2-amino-2-oxoethyl)-N-cyclopentyl-3-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 115645919 |
| Molecular Formula | C13H16FN3O2 |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-N-cyclopentyl-3-fluoropyridine-4-carboxamide |
| SMILES | NC(=O)CN(C(=O)c1ccncc1F)C1CCCC1 |
| InChI | InChI=1S/C13H16FN3O2/c14-11-7-16-6-5-10(11)13(19)17(8-12(15)18)9-3-1-2-4-9/h5-7,9H,1-4,8H2,(H2,15,18) |
| InChIKey | YDBOTWCJRGLLSZ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |