C13H18N4O3 — CID 81445654
N-(2-amino-2-oxoethyl)-3-hydroxy-N-piperidin-3-ylpyridine-4-carboxamide (PubChem CID 81445654) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-3-hydroxy-N-piperidin-3-ylpyridine-4-carboxamide.
| Compound Name | N-(2-amino-2-oxoethyl)-3-hydroxy-N-piperidin-3-ylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 81445654 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-3-hydroxy-N-piperidin-3-ylpyridine-4-carboxamide |
| SMILES | NC(=O)CN(C(=O)c1ccncc1O)C1CCCNC1 |
| InChI | InChI=1S/C13H18N4O3/c14-12(19)8-17(9-2-1-4-15-6-9)13(20)10-3-5-16-7-11(10)18/h3,5,7,9,15,18H,1-2,4,6,8H2,(H2,14,19) |
| InChIKey | FIRRHTDOQWSKFJ-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |