C16H23N3O2 — CID 60800165
N-(2-amino-2-oxoethyl)-2,5-dimethyl-N-piperidin-3-ylbenzamide (PubChem CID 60800165) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-2,5-dimethyl-N-piperidin-3-ylbenzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-2,5-dimethyl-N-piperidin-3-ylbenzamide |
|---|---|
| PubChem CID | 60800165 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-2,5-dimethyl-N-piperidin-3-ylbenzamide |
| SMILES | Cc1ccc(C)c(C(=O)N(CC(N)=O)C2CCCNC2)c1 |
| InChI | InChI=1S/C16H23N3O2/c1-11-5-6-12(2)14(8-11)16(21)19(10-15(17)20)13-4-3-7-18-9-13/h5-6,8,13,18H,3-4,7,9-10H2,1-2H3,(H2,17,20) |
| InChIKey | JQMMSPZFDSXNLE-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |