C20H26N4O — CID 129465935
N-[(4R)-azepan-4-yl]-2,5-dimethyl-N-(pyrimidin-5-ylmethyl)benzamide (PubChem CID 129465935) has the molecular formula C20H26N4O and a molecular weight of 338.46 g/mol. Its IUPAC name is N-[(4R)-azepan-4-yl]-2,5-dimethyl-N-(pyrimidin-5-ylmethyl)benzamide.
| Compound Name | N-[(4R)-azepan-4-yl]-2,5-dimethyl-N-(pyrimidin-5-ylmethyl)benzamide |
|---|---|
| PubChem CID | 129465935 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | N-[(4R)-azepan-4-yl]-2,5-dimethyl-N-(pyrimidin-5-ylmethyl)benzamide |
| SMILES | Cc1ccc(C)c(C(=O)N(Cc2cncnc2)[C@@H]2CCCNCC2)c1 |
| InChI | InChI=1S/C20H26N4O/c1-15-5-6-16(2)19(10-15)20(25)24(13-17-11-22-14-23-12-17)18-4-3-8-21-9-7-18/h5-6,10-12,14,18,21H,3-4,7-9,13H2,1-2H3/t18-/m1/s1 |
| InChIKey | MCMQNOAIUPJKNB-GOSISDBHSA-N |
| XLogP | 2.88 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |