C17H19NOS — CID 51055390
N-cyclopropyl-2,5-dimethyl-N-(thiophen-3-ylmethyl)benzamide (PubChem CID 51055390) has the molecular formula C17H19NOS and a molecular weight of 285.41 g/mol. Its IUPAC name is N-cyclopropyl-2,5-dimethyl-N-(thiophen-3-ylmethyl)benzamide.
| Compound Name | N-cyclopropyl-2,5-dimethyl-N-(thiophen-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 51055390 |
| Molecular Formula | C17H19NOS |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | N-cyclopropyl-2,5-dimethyl-N-(thiophen-3-ylmethyl)benzamide |
| SMILES | Cc1ccc(C)c(C(=O)N(Cc2ccsc2)C2CC2)c1 |
| InChI | InChI=1S/C17H19NOS/c1-12-3-4-13(2)16(9-12)17(19)18(15-5-6-15)10-14-7-8-20-11-14/h3-4,7-9,11,15H,5-6,10H2,1-2H3 |
| InChIKey | UTTLGJAXPIQTPG-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |