C15H14INOS — CID 61400460
N-cyclopropyl-3-iodo-N-(thiophen-3-ylmethyl)benzamide (PubChem CID 61400460) has the molecular formula C15H14INOS and a molecular weight of 383.25 g/mol. Its IUPAC name is N-cyclopropyl-3-iodo-N-(thiophen-3-ylmethyl)benzamide.
| Compound Name | N-cyclopropyl-3-iodo-N-(thiophen-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 61400460 |
| Molecular Formula | C15H14INOS |
| Molecular Weight | 383.25 g/mol |
| Exact Mass | 382.98 |
| IUPAC Name | N-cyclopropyl-3-iodo-N-(thiophen-3-ylmethyl)benzamide |
| SMILES | O=C(c1cccc(I)c1)N(Cc1ccsc1)C1CC1 |
| InChI | InChI=1S/C15H14INOS/c16-13-3-1-2-12(8-13)15(18)17(14-4-5-14)9-11-6-7-19-10-11/h1-3,6-8,10,14H,4-5,9H2 |
| InChIKey | RZZYILFSEKVRPI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.25 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|