C20H20N4OS — CID 122565811
N-cyclopropyl-3-[4-(methylamino)pyrimidin-2-yl]-N-(thiophen-3-ylmethyl)benzamide (PubChem CID 122565811) has the molecular formula C20H20N4OS and a molecular weight of 364.47 g/mol. Its IUPAC name is N-cyclopropyl-3-[4-(methylamino)pyrimidin-2-yl]-N-(thiophen-3-ylmethyl)benzamide.
| Compound Name | N-cyclopropyl-3-[4-(methylamino)pyrimidin-2-yl]-N-(thiophen-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 122565811 |
| Molecular Formula | C20H20N4OS |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | N-cyclopropyl-3-[4-(methylamino)pyrimidin-2-yl]-N-(thiophen-3-ylmethyl)benzamide |
| SMILES | CNc1ccnc(-c2cccc(C(=O)N(Cc3ccsc3)C3CC3)c2)n1 |
| InChI | InChI=1S/C20H20N4OS/c1-21-18-7-9-22-19(23-18)15-3-2-4-16(11-15)20(25)24(17-5-6-17)12-14-8-10-26-13-14/h2-4,7-11,13,17H,5-6,12H2,1H3,(H,21,22,23) |
| InChIKey | OZEZTIRREJHGFK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |