C17H17NO2 — CID 64592060
N-cyclopropyl-N-[(3-hydroxyphenyl)methyl]benzamide (PubChem CID 64592060) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is N-cyclopropyl-N-[(3-hydroxyphenyl)methyl]benzamide.
| Compound Name | N-cyclopropyl-N-[(3-hydroxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 64592060 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | N-cyclopropyl-N-[(3-hydroxyphenyl)methyl]benzamide |
| SMILES | O=C(c1ccccc1)N(Cc1cccc(O)c1)C1CC1 |
| InChI | InChI=1S/C17H17NO2/c19-16-8-4-5-13(11-16)12-18(15-9-10-15)17(20)14-6-2-1-3-7-14/h1-8,11,15,19H,9-10,12H2 |
| InChIKey | JRDQGMCTAXRECX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |