C16H17BrN2O2 — CID 60956180
4-bromo-N-cyclopropyl-N-[(3-hydroxyphenyl)methyl]-1-methylpyrrole-2-carboxamide (PubChem CID 60956180) has the molecular formula C16H17BrN2O2 and a molecular weight of 349.23 g/mol. Its IUPAC name is 4-bromo-N-cyclopropyl-N-[(3-hydroxyphenyl)methyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-cyclopropyl-N-[(3-hydroxyphenyl)methyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 60956180 |
| Molecular Formula | C16H17BrN2O2 |
| Molecular Weight | 349.23 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 4-bromo-N-cyclopropyl-N-[(3-hydroxyphenyl)methyl]-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cc(Br)cc1C(=O)N(Cc1cccc(O)c1)C1CC1 |
| InChI | InChI=1S/C16H17BrN2O2/c1-18-10-12(17)8-15(18)16(21)19(13-5-6-13)9-11-3-2-4-14(20)7-11/h2-4,7-8,10,13,20H,5-6,9H2,1H3 |
| InChIKey | KBGKPFJCSZXWSC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.23 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |