C15H22N2O2 — CID 93375654
(2S)-2-amino-N-cyclopropyl-N-[(3-hydroxyphenyl)methyl]pentanamide (PubChem CID 93375654) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is (2S)-2-amino-N-cyclopropyl-N-[(3-hydroxyphenyl)methyl]pentanamide.
| Compound Name | (2S)-2-amino-N-cyclopropyl-N-[(3-hydroxyphenyl)methyl]pentanamide |
|---|---|
| PubChem CID | 93375654 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | (2S)-2-amino-N-cyclopropyl-N-[(3-hydroxyphenyl)methyl]pentanamide |
| SMILES | CCC[C@H](N)C(=O)N(Cc1cccc(O)c1)C1CC1 |
| InChI | InChI=1S/C15H22N2O2/c1-2-4-14(16)15(19)17(12-7-8-12)10-11-5-3-6-13(18)9-11/h3,5-6,9,12,14,18H,2,4,7-8,10,16H2,1H3/t14-/m0/s1 |
| InChIKey | DWUNVPJWBYVMSG-AWEZNQCLSA-N |
| XLogP | 2.01 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |