C14H18N2O2 — CID 114997619
2-amino-N-cyclopropyl-N-[(3-hydroxyphenyl)methyl]cyclopropane-1-carboxamide (PubChem CID 114997619) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-amino-N-cyclopropyl-N-[(3-hydroxyphenyl)methyl]cyclopropane-1-carboxamide.
| Compound Name | 2-amino-N-cyclopropyl-N-[(3-hydroxyphenyl)methyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 114997619 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 2-amino-N-cyclopropyl-N-[(3-hydroxyphenyl)methyl]cyclopropane-1-carboxamide |
| SMILES | NC1CC1C(=O)N(Cc1cccc(O)c1)C1CC1 |
| InChI | InChI=1S/C14H18N2O2/c15-13-7-12(13)14(18)16(10-4-5-10)8-9-2-1-3-11(17)6-9/h1-3,6,10,12-13,17H,4-5,7-8,15H2 |
| InChIKey | HFNXTTADCSRBIM-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |