C18H19NO2 — CID 71935827
N-benzyl-N-cyclopropyl-2-(3-hydroxyphenyl)acetamide (PubChem CID 71935827) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is N-benzyl-N-cyclopropyl-2-(3-hydroxyphenyl)acetamide.
| Compound Name | N-benzyl-N-cyclopropyl-2-(3-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 71935827 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | N-benzyl-N-cyclopropyl-2-(3-hydroxyphenyl)acetamide |
| SMILES | O=C(Cc1cccc(O)c1)N(Cc1ccccc1)C1CC1 |
| InChI | InChI=1S/C18H19NO2/c20-17-8-4-7-15(11-17)12-18(21)19(16-9-10-16)13-14-5-2-1-3-6-14/h1-8,11,16,20H,9-10,12-13H2 |
| InChIKey | SWIPDAKERBTMEJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |