C16H27ClN4OS — CID 154753787
N-(azepan-4-yl)-4-methylsulfanyl-N-(pyrimidin-5-ylmethyl)butanamide;hydrochloride (PubChem CID 154753787) has the molecular formula C16H27ClN4OS and a molecular weight of 358.94 g/mol. Its IUPAC name is N-(azepan-4-yl)-4-methylsulfanyl-N-(pyrimidin-5-ylmethyl)butanamide;hydrochloride.
| Compound Name | N-(azepan-4-yl)-4-methylsulfanyl-N-(pyrimidin-5-ylmethyl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 154753787 |
| Molecular Formula | C16H27ClN4OS |
| Molecular Weight | 358.94 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | N-(azepan-4-yl)-4-methylsulfanyl-N-(pyrimidin-5-ylmethyl)butanamide;hydrochloride |
| SMILES | CSCCCC(=O)N(Cc1cncnc1)C1CCCNCC1.Cl |
| InChI | InChI=1S/C16H26N4OS.ClH/c1-22-9-3-5-16(21)20(12-14-10-18-13-19-11-14)15-4-2-7-17-8-6-15;/h10-11,13,15,17H,2-9,12H2,1H3;1H |
| InChIKey | GUKCEVLRPOYZJL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.94 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|